C19H23NO — CID 173304585
(2E)-9-[4-(dimethylamino)phenyl]-3,7-dimethylnona-2,4,6,8-tetraenal (PubChem CID 173304585) has the molecular formula C19H23NO and a molecular weight of 281.40 g/mol. Its IUPAC name is (2E)-9-[4-(dimethylamino)phenyl]-3,7-dimethylnona-2,4,6,8-tetraenal.
| Compound Name | (2E)-9-[4-(dimethylamino)phenyl]-3,7-dimethylnona-2,4,6,8-tetraenal |
|---|---|
| PubChem CID | 173304585 |
| Molecular Formula | C19H23NO |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | (2E)-9-[4-(dimethylamino)phenyl]-3,7-dimethylnona-2,4,6,8-tetraenal |
| SMILES | CC(C=Cc1ccc(N(C)C)cc1)=CC=C/C(C)=C/C=O |
| InChI | InChI=1S/C19H23NO/c1-16(6-5-7-17(2)14-15-21)8-9-18-10-12-19(13-11-18)20(3)4/h5-15H,1-4H3/b7-5?,9-8?,16-6?,17-14+ |
| InChIKey | LYVPDAVLABNTOF-LMJQAFODSA-N |
| XLogP | 4.41 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|