C34H36O4 — CID 76584559
4-[18-(3,4-dihydroxyphenyl)-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]benzene-1,2-diol (PubChem CID 76584559) has the molecular formula C34H36O4 and a molecular weight of 508.66 g/mol. Its IUPAC name is 4-[18-(3,4-dihydroxyphenyl)-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]benzene-1,2-diol.
| Compound Name | 4-[18-(3,4-dihydroxyphenyl)-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 76584559 |
| Molecular Formula | C34H36O4 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | 4-[18-(3,4-dihydroxyphenyl)-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]benzene-1,2-diol |
| SMILES | CC(C=CC=C(C)C=Cc1ccc(O)c(O)c1)=CC=CC=C(C)C=CC=C(C)C=Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C34H36O4/c1-25(11-7-13-27(3)15-17-29-19-21-31(35)33(37)23-29)9-5-6-10-26(2)12-8-14-28(4)16-18-30-20-22-32(36)34(38)24-30/h5-24,35-38H,1-4H3 |
| InChIKey | ABUKNVVDQIZQOP-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|