C12H16N2O3 — CID 141488268
4,4-diamino-1-(3,4-dihydroxyphenyl)hex-1-en-3-one (PubChem CID 141488268) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is 4,4-diamino-1-(3,4-dihydroxyphenyl)hex-1-en-3-one.
| Compound Name | 4,4-diamino-1-(3,4-dihydroxyphenyl)hex-1-en-3-one |
|---|---|
| PubChem CID | 141488268 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 4,4-diamino-1-(3,4-dihydroxyphenyl)hex-1-en-3-one |
| SMILES | CCC(N)(N)C(=O)C=Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C12H16N2O3/c1-2-12(13,14)11(17)6-4-8-3-5-9(15)10(16)7-8/h3-7,15-16H,2,13-14H2,1H3 |
| InChIKey | HOQTUSTWAIDULR-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|