C12H14O3 — CID 123620299
1-(3,4-dihydroxyphenyl)-4-methylpent-1-en-3-one (PubChem CID 123620299) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is 1-(3,4-dihydroxyphenyl)-4-methylpent-1-en-3-one.
| Compound Name | 1-(3,4-dihydroxyphenyl)-4-methylpent-1-en-3-one |
|---|---|
| PubChem CID | 123620299 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 1-(3,4-dihydroxyphenyl)-4-methylpent-1-en-3-one |
| SMILES | CC(C)C(=O)C=Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C12H14O3/c1-8(2)10(13)5-3-9-4-6-11(14)12(15)7-9/h3-8,14-15H,1-2H3 |
| InChIKey | JVEUGOSWZRLHMC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|