C22H18O12 — CID 66860062
(2R,3R)-2,3-bis[3-(3,4-dihydroxyphenyl)prop-2-enoyl]-2,3-dihydroxybutanedioic acid (PubChem CID 66860062) has the molecular formula C22H18O12 and a molecular weight of 474.37 g/mol. Its IUPAC name is (2R,3R)-2,3-bis[3-(3,4-dihydroxyphenyl)prop-2-enoyl]-2,3-dihydroxybutanedioic acid.
| Compound Name | (2R,3R)-2,3-bis[3-(3,4-dihydroxyphenyl)prop-2-enoyl]-2,3-dihydroxybutanedioic acid |
|---|---|
| PubChem CID | 66860062 |
| Molecular Formula | C22H18O12 |
| Molecular Weight | 474.37 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | (2R,3R)-2,3-bis[3-(3,4-dihydroxyphenyl)prop-2-enoyl]-2,3-dihydroxybutanedioic acid |
| SMILES | O=C(O)[C@](O)(C(=O)C=Cc1ccc(O)c(O)c1)[C@](O)(C(=O)O)C(=O)C=Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C22H18O12/c23-13-5-1-11(9-15(13)25)3-7-17(27)21(33,19(29)30)22(34,20(31)32)18(28)8-4-12-2-6-14(24)16(26)10-12/h1-10,23-26,33-34H,(H,29,30)(H,31,32)/t21-,22-/m1/s1 |
| InChIKey | IHFPHNHRXPJFAJ-FGZHOGPDSA-N |
| XLogP | 0.01 |
| TPSA | 230.12 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.37 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|