C20H16O10 — CID 171037560
2-benzoyl-3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]-2,3-dihydroxybutanedioic acid (PubChem CID 171037560) has the molecular formula C20H16O10 and a molecular weight of 416.34 g/mol. Its IUPAC name is 2-benzoyl-3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]-2,3-dihydroxybutanedioic acid.
| Compound Name | 2-benzoyl-3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]-2,3-dihydroxybutanedioic acid |
|---|---|
| PubChem CID | 171037560 |
| Molecular Formula | C20H16O10 |
| Molecular Weight | 416.34 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | 2-benzoyl-3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]-2,3-dihydroxybutanedioic acid |
| SMILES | O=C(O)C(O)(C(=O)/C=C/c1ccc(O)c(O)c1)C(O)(C(=O)O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C20H16O10/c21-13-8-6-11(10-14(13)22)7-9-15(23)19(29,17(25)26)20(30,18(27)28)16(24)12-4-2-1-3-5-12/h1-10,21-22,29-30H,(H,25,26)(H,27,28)/b9-7+ |
| InChIKey | BQKDETSUXCCCDO-VQHVLOKHSA-N |
| XLogP | 0.19 |
| TPSA | 189.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.34 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|