C18H14O8 — CID 141186854
2,3-dibenzoyl-4-deuteriooxy-2,3-dihydroxy-4-oxobutanoic acid (PubChem CID 141186854) has the molecular formula C18H14O8 and a molecular weight of 359.31 g/mol. Its IUPAC name is 2,3-dibenzoyl-4-deuteriooxy-2,3-dihydroxy-4-oxobutanoic acid.
| Compound Name | 2,3-dibenzoyl-4-deuteriooxy-2,3-dihydroxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 141186854 |
| Molecular Formula | C18H14O8 |
| Molecular Weight | 359.31 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 2,3-dibenzoyl-4-deuteriooxy-2,3-dihydroxy-4-oxobutanoic acid |
| SMILES | [2H]OC(=O)C(O)(C(=O)c1ccccc1)C(O)(C(=O)O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C18H14O8/c19-13(11-7-3-1-4-8-11)17(25,15(21)22)18(26,16(23)24)14(20)12-9-5-2-6-10-12/h1-10,25-26H,(H,21,22)(H,23,24)/i/hD |
| InChIKey | OCQAXYHNMWVLRH-DYCDLGHISA-N |
| XLogP | 0.38 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.31 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|