C12H12O7 — CID 141115442
2-benzoyl-2,3-dihydroxy-3-methylbutanedioic acid (PubChem CID 141115442) has the molecular formula C12H12O7 and a molecular weight of 268.22 g/mol. Its IUPAC name is 2-benzoyl-2,3-dihydroxy-3-methylbutanedioic acid.
| Compound Name | 2-benzoyl-2,3-dihydroxy-3-methylbutanedioic acid |
|---|---|
| PubChem CID | 141115442 |
| Molecular Formula | C12H12O7 |
| Molecular Weight | 268.22 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 2-benzoyl-2,3-dihydroxy-3-methylbutanedioic acid |
| SMILES | CC(O)(C(=O)O)C(O)(C(=O)O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C12H12O7/c1-11(18,9(14)15)12(19,10(16)17)8(13)7-5-3-2-4-6-7/h2-6,18-19H,1H3,(H,14,15)(H,16,17) |
| InChIKey | YBSGTMDAWDFYGC-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.22 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|