C14H16O5 — CID 175533382
(2S)-2-benzoyl-2,3,3-trimethylbutanedioic acid (PubChem CID 175533382) has the molecular formula C14H16O5 and a molecular weight of 264.28 g/mol. Its IUPAC name is (2S)-2-benzoyl-2,3,3-trimethylbutanedioic acid.
| Compound Name | (2S)-2-benzoyl-2,3,3-trimethylbutanedioic acid |
|---|---|
| PubChem CID | 175533382 |
| Molecular Formula | C14H16O5 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | (2S)-2-benzoyl-2,3,3-trimethylbutanedioic acid |
| SMILES | CC(C)(C(=O)O)[C@](C)(C(=O)O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C14H16O5/c1-13(2,11(16)17)14(3,12(18)19)10(15)9-7-5-4-6-8-9/h4-8H,1-3H3,(H,16,17)(H,18,19)/t14-/m0/s1 |
| InChIKey | LUGCENDPUUUKAQ-AWEZNQCLSA-N |
| XLogP | 2.07 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|