C15H17F3O3 — CID 102326768
tert-butyl 2-benzoyl-3,3,3-trifluoro-2-methylpropanoate (PubChem CID 102326768) has the molecular formula C15H17F3O3 and a molecular weight of 302.29 g/mol. Its IUPAC name is tert-butyl 2-benzoyl-3,3,3-trifluoro-2-methylpropanoate.
| Compound Name | tert-butyl 2-benzoyl-3,3,3-trifluoro-2-methylpropanoate |
|---|---|
| PubChem CID | 102326768 |
| Molecular Formula | C15H17F3O3 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | tert-butyl 2-benzoyl-3,3,3-trifluoro-2-methylpropanoate |
| SMILES | CC(C)(C)OC(=O)C(C)(C(=O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C15H17F3O3/c1-13(2,3)21-12(20)14(4,15(16,17)18)11(19)10-8-6-5-7-9-10/h5-9H,1-4H3 |
| InChIKey | XWEBIMSSLGWREX-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|