(2S,3R)-2-benzoyl-2,3-dihydroxy-3-methoxybutanedioic acid

C12H12O8 — CID 141050108

IUPAC(2S,3R)-2-benzoyl-2,3-dihydroxy-3-methoxybutanedioic acid
SMILESCO[C@@](O)(C(=O)O)[C@](O)(C(=O)O)C(=O)c1ccccc1
InChIInChI=1S/C12H12O8/c1-20-12(19,10(16)17)11(18,9(14)15)8(13)7-5-3-2-4-6-7/h2-6,18-19H,1H3,(H,14,15)(H,16,17)/t11-,12+/m1/s1
InChIKeyTUKVPUFCHWKAIG-NEPJUHHUSA-N
MW284.22 g/mol
LogP-0.90
Rot. Bonds6

About (2S,3R)-2-benzoyl-2,3-dihydroxy-3-methoxybutanedioic acid

(2S,3R)-2-benzoyl-2,3-dihydroxy-3-methoxybutanedioic acid (PubChem CID 141050108) has the molecular formula C12H12O8 and a molecular weight of 284.22 g/mol. Its IUPAC name is (2S,3R)-2-benzoyl-2,3-dihydroxy-3-methoxybutanedioic acid.

Molecular Properties

Compound Name(2S,3R)-2-benzoyl-2,3-dihydroxy-3-methoxybutanedioic acid
PubChem CID141050108
Molecular FormulaC12H12O8
Molecular Weight284.22 g/mol
Exact Mass284.05
IUPAC Name(2S,3R)-2-benzoyl-2,3-dihydroxy-3-methoxybutanedioic acid
SMILESCO[C@@](O)(C(=O)O)[C@](O)(C(=O)O)C(=O)c1ccccc1
InChIInChI=1S/C12H12O8/c1-20-12(19,10(16)17)11(18,9(14)15)8(13)7-5-3-2-4-6-7/h2-6,18-19H,1H3,(H,14,15)(H,16,17)/t11-,12+/m1/s1
InChIKeyTUKVPUFCHWKAIG-NEPJUHHUSA-N
XLogP-0.90
TPSA141.36 Ų
H-Bond Donors4
H-Bond Acceptors6
Rotatable Bonds6
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500284.22
LogP ≤ 5-0.90
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze (2S,3R)-2-benzoyl-2,3-dihydroxy-3-methoxybutanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S,3R)-2-benzoyl-2,3-dihydroxy-3-methoxybutanedioic acid?
The IUPAC name of (2S,3R)-2-benzoyl-2,3-dihydroxy-3-methoxybutanedioic acid (CID 141050108) is (2S,3R)-2-benzoyl-2,3-dihydroxy-3-methoxybutanedioic acid.
What is the SMILES notation for (2S,3R)-2-benzoyl-2,3-dihydroxy-3-methoxybutanedioic acid?
The canonical SMILES for (2S,3R)-2-benzoyl-2,3-dihydroxy-3-methoxybutanedioic acid is CO[C@@](O)(C(=O)O)[C@](O)(C(=O)O)C(=O)c1ccccc1.
What is the InChIKey of (2S,3R)-2-benzoyl-2,3-dihydroxy-3-methoxybutanedioic acid?
The InChIKey is TUKVPUFCHWKAIG-NEPJUHHUSA-N. The full InChI is InChI=1S/C12H12O8/c1-20-12(19,10(16)17)11(18,9(14)15)8(13)7-5-3-2-4-6-7/h2-6,18-19H,1H3,(H,14,15)(H,16,17)/t11-,12+/m1/s1.
What are the key properties of (2S,3R)-2-benzoyl-2,3-dihydroxy-3-methoxybutanedioic acid?
(2S,3R)-2-benzoyl-2,3-dihydroxy-3-methoxybutanedioic acid has a molecular weight of 284.22 g/mol, XLogP of -0.90, 6 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3R)-2-benzoyl-2,3-dihydroxy-3-methoxybutanedioic acid is sourced from PubChem (CID 141050108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).