C12H12O8 — CID 141050108
(2S,3R)-2-benzoyl-2,3-dihydroxy-3-methoxybutanedioic acid (PubChem CID 141050108) has the molecular formula C12H12O8 and a molecular weight of 284.22 g/mol. Its IUPAC name is (2S,3R)-2-benzoyl-2,3-dihydroxy-3-methoxybutanedioic acid.
| Compound Name | (2S,3R)-2-benzoyl-2,3-dihydroxy-3-methoxybutanedioic acid |
|---|---|
| PubChem CID | 141050108 |
| Molecular Formula | C12H12O8 |
| Molecular Weight | 284.22 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | (2S,3R)-2-benzoyl-2,3-dihydroxy-3-methoxybutanedioic acid |
| SMILES | CO[C@@](O)(C(=O)O)[C@](O)(C(=O)O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C12H12O8/c1-20-12(19,10(16)17)11(18,9(14)15)8(13)7-5-3-2-4-6-7/h2-6,18-19H,1H3,(H,14,15)(H,16,17)/t11-,12+/m1/s1 |
| InChIKey | TUKVPUFCHWKAIG-NEPJUHHUSA-N |
| XLogP | -0.90 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.22 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|