C20H18O10 — CID 66875563
(2S,3S)-2,3-dihydroxy-2,3-bis(4-methoxybenzoyl)butanedioic acid (PubChem CID 66875563) has the molecular formula C20H18O10 and a molecular weight of 418.35 g/mol. Its IUPAC name is (2S,3S)-2,3-dihydroxy-2,3-bis(4-methoxybenzoyl)butanedioic acid.
| Compound Name | (2S,3S)-2,3-dihydroxy-2,3-bis(4-methoxybenzoyl)butanedioic acid |
|---|---|
| PubChem CID | 66875563 |
| Molecular Formula | C20H18O10 |
| Molecular Weight | 418.35 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | (2S,3S)-2,3-dihydroxy-2,3-bis(4-methoxybenzoyl)butanedioic acid |
| SMILES | COc1ccc(C(=O)[C@](O)(C(=O)O)[C@@](O)(C(=O)O)C(=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C20H18O10/c1-29-13-7-3-11(4-8-13)15(21)19(27,17(23)24)20(28,18(25)26)16(22)12-5-9-14(30-2)10-6-12/h3-10,27-28H,1-2H3,(H,23,24)(H,25,26)/t19-,20-/m0/s1 |
| InChIKey | CCIUQRKCMXXTOI-PMACEKPBSA-N |
| XLogP | 0.40 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.35 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|