C12H12O8 — CID 175754688
(2S,3R)-2,3-dihydroxy-2-(4-methoxybenzoyl)butanedioic acid (PubChem CID 175754688) has the molecular formula C12H12O8 and a molecular weight of 284.22 g/mol. Its IUPAC name is (2S,3R)-2,3-dihydroxy-2-(4-methoxybenzoyl)butanedioic acid.
| Compound Name | (2S,3R)-2,3-dihydroxy-2-(4-methoxybenzoyl)butanedioic acid |
|---|---|
| PubChem CID | 175754688 |
| Molecular Formula | C12H12O8 |
| Molecular Weight | 284.22 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | (2S,3R)-2,3-dihydroxy-2-(4-methoxybenzoyl)butanedioic acid |
| SMILES | COc1ccc(C(=O)[C@](O)(C(=O)O)[C@@H](O)C(=O)O)cc1 |
| InChI | InChI=1S/C12H12O8/c1-20-7-4-2-6(3-5-7)8(13)12(19,11(17)18)9(14)10(15)16/h2-5,9,14,19H,1H3,(H,15,16)(H,17,18)/t9-,12+/m0/s1 |
| InChIKey | IAJFCAIBAPJCDA-JOYOIKCWSA-N |
| XLogP | -0.86 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.22 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|