C9H11NaO4 — CID 173420090
sodium;2,2-dihydroxy-1-(4-methoxyphenyl)ethanone;hydride (PubChem CID 173420090) has the molecular formula C9H11NaO4 and a molecular weight of 206.17 g/mol. Its IUPAC name is sodium;2,2-dihydroxy-1-(4-methoxyphenyl)ethanone;hydride.
| Compound Name | sodium;2,2-dihydroxy-1-(4-methoxyphenyl)ethanone;hydride |
|---|---|
| PubChem CID | 173420090 |
| Molecular Formula | C9H11NaO4 |
| Molecular Weight | 206.17 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | sodium;2,2-dihydroxy-1-(4-methoxyphenyl)ethanone;hydride |
| SMILES | COc1ccc(C(=O)C(O)O)cc1.[H-].[Na+] |
| InChI | InChI=1S/C9H10O4.Na.H/c1-13-7-4-2-6(3-5-7)8(10)9(11)12;;/h2-5,9,11-12H,1H3;;/q;+1;-1 |
| InChIKey | KSTTYSXJRDQJLB-UHFFFAOYSA-N |
| XLogP | -2.69 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.17 |
| LogP ≤ 5 | -2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|