C12H16O5 — CID 11424975
(2R)-2-hydroxy-3,3-dimethoxy-1-(4-methoxyphenyl)propan-1-one (PubChem CID 11424975) has the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. Its IUPAC name is (2R)-2-hydroxy-3,3-dimethoxy-1-(4-methoxyphenyl)propan-1-one.
| Compound Name | (2R)-2-hydroxy-3,3-dimethoxy-1-(4-methoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 11424975 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | (2R)-2-hydroxy-3,3-dimethoxy-1-(4-methoxyphenyl)propan-1-one |
| SMILES | COc1ccc(C(=O)[C@H](O)C(OC)OC)cc1 |
| InChI | InChI=1S/C12H16O5/c1-15-9-6-4-8(5-7-9)10(13)11(14)12(16-2)17-3/h4-7,11-12,14H,1-3H3/t11-/m0/s1 |
| InChIKey | RLEMMYWHQVZXHM-NSHDSACASA-N |
| XLogP | 0.86 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|