C23H27NO9 — CID 68509755
2,3-dibenzoyl-2,3-dihydroxybutanedioic acid;(2R)-1-(dimethylamino)propan-2-ol (PubChem CID 68509755) has the molecular formula C23H27NO9 and a molecular weight of 461.47 g/mol. Its IUPAC name is 2,3-dibenzoyl-2,3-dihydroxybutanedioic acid;(2R)-1-(dimethylamino)propan-2-ol.
| Compound Name | 2,3-dibenzoyl-2,3-dihydroxybutanedioic acid;(2R)-1-(dimethylamino)propan-2-ol |
|---|---|
| PubChem CID | 68509755 |
| Molecular Formula | C23H27NO9 |
| Molecular Weight | 461.47 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | 2,3-dibenzoyl-2,3-dihydroxybutanedioic acid;(2R)-1-(dimethylamino)propan-2-ol |
| SMILES | C[C@@H](O)CN(C)C.O=C(O)C(O)(C(=O)c1ccccc1)C(O)(C(=O)O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C18H14O8.C5H13NO/c19-13(11-7-3-1-4-8-11)17(25,15(21)22)18(26,16(23)24)14(20)12-9-5-2-6-10-12;1-5(7)4-6(2)3/h1-10,25-26H,(H,21,22)(H,23,24);5,7H,4H2,1-3H3/t;5-/m.1/s1 |
| InChIKey | JFZAVIZJUBOYJQ-QDXATWJZSA-N |
| XLogP | 0.31 |
| TPSA | 172.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.47 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|