C18H20O3 — CID 14433421
2,3-dihydroxy-4-methyl-1,2-diphenylpentan-1-one (PubChem CID 14433421) has the molecular formula C18H20O3 and a molecular weight of 284.36 g/mol. Its IUPAC name is 2,3-dihydroxy-4-methyl-1,2-diphenylpentan-1-one.
| Compound Name | 2,3-dihydroxy-4-methyl-1,2-diphenylpentan-1-one |
|---|---|
| PubChem CID | 14433421 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 2,3-dihydroxy-4-methyl-1,2-diphenylpentan-1-one |
| SMILES | CC(C)C(O)C(O)(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H20O3/c1-13(2)16(19)18(21,15-11-7-4-8-12-15)17(20)14-9-5-3-6-10-14/h3-13,16,19,21H,1-2H3 |
| InChIKey | BIBNNFXFEQYAFI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |