C23H20O2 — CID 11370873
2-hydroxy-1,2,3-triphenylpent-4-en-1-one (PubChem CID 11370873) has the molecular formula C23H20O2 and a molecular weight of 328.41 g/mol. Its IUPAC name is 2-hydroxy-1,2,3-triphenylpent-4-en-1-one.
| Compound Name | 2-hydroxy-1,2,3-triphenylpent-4-en-1-one |
|---|---|
| PubChem CID | 11370873 |
| Molecular Formula | C23H20O2 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 2-hydroxy-1,2,3-triphenylpent-4-en-1-one |
| SMILES | C=CC(c1ccccc1)C(O)(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H20O2/c1-2-21(18-12-6-3-7-13-18)23(25,20-16-10-5-11-17-20)22(24)19-14-8-4-9-15-19/h2-17,21,25H,1H2 |
| InChIKey | CBWZCFFPPIYVCH-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|