C25H24O3 — CID 132538281
(2S,3R)-2-(methoxymethoxy)-1,2,3-triphenylpent-4-en-1-one (PubChem CID 132538281) has the molecular formula C25H24O3 and a molecular weight of 372.46 g/mol. Its IUPAC name is (2S,3R)-2-(methoxymethoxy)-1,2,3-triphenylpent-4-en-1-one.
| Compound Name | (2S,3R)-2-(methoxymethoxy)-1,2,3-triphenylpent-4-en-1-one |
|---|---|
| PubChem CID | 132538281 |
| Molecular Formula | C25H24O3 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | (2S,3R)-2-(methoxymethoxy)-1,2,3-triphenylpent-4-en-1-one |
| SMILES | C=C[C@H](c1ccccc1)[C@@](OCOC)(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H24O3/c1-3-23(20-13-7-4-8-14-20)25(28-19-27-2,22-17-11-6-12-18-22)24(26)21-15-9-5-10-16-21/h3-18,23H,1,19H2,2H3/t23-,25-/m1/s1 |
| InChIKey | PJTHKZXDWHKIQG-ILBGXUMGSA-N |
| XLogP | 5.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|