C25H21F3O2 — CID 132538275
(2S,3R)-2-methoxy-1,2-diphenyl-3-[4-(trifluoromethyl)phenyl]pent-4-en-1-one (PubChem CID 132538275) has the molecular formula C25H21F3O2 and a molecular weight of 410.44 g/mol. Its IUPAC name is (2S,3R)-2-methoxy-1,2-diphenyl-3-[4-(trifluoromethyl)phenyl]pent-4-en-1-one.
| Compound Name | (2S,3R)-2-methoxy-1,2-diphenyl-3-[4-(trifluoromethyl)phenyl]pent-4-en-1-one |
|---|---|
| PubChem CID | 132538275 |
| Molecular Formula | C25H21F3O2 |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | (2S,3R)-2-methoxy-1,2-diphenyl-3-[4-(trifluoromethyl)phenyl]pent-4-en-1-one |
| SMILES | C=C[C@H](c1ccc(C(F)(F)F)cc1)[C@@](OC)(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H21F3O2/c1-3-22(18-14-16-21(17-15-18)25(26,27)28)24(30-2,20-12-8-5-9-13-20)23(29)19-10-6-4-7-11-19/h3-17,22H,1H2,2H3/t22-,24-/m1/s1 |
| InChIKey | PRYVZJORACNUBU-ISKFKSNPSA-N |
| XLogP | 6.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|