C25H24O2 — CID 134955659
(2R,3R)-2-methoxy-3-(4-methylphenyl)-1,2-diphenylpent-4-en-1-one (PubChem CID 134955659) has the molecular formula C25H24O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is (2R,3R)-2-methoxy-3-(4-methylphenyl)-1,2-diphenylpent-4-en-1-one.
| Compound Name | (2R,3R)-2-methoxy-3-(4-methylphenyl)-1,2-diphenylpent-4-en-1-one |
|---|---|
| PubChem CID | 134955659 |
| Molecular Formula | C25H24O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | (2R,3R)-2-methoxy-3-(4-methylphenyl)-1,2-diphenylpent-4-en-1-one |
| SMILES | C=C[C@H](c1ccc(C)cc1)[C@](OC)(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H24O2/c1-4-23(20-17-15-19(2)16-18-20)25(27-3,22-13-9-6-10-14-22)24(26)21-11-7-5-8-12-21/h4-18,23H,1H2,2-3H3/t23-,25+/m1/s1 |
| InChIKey | OGNJBZKBZLGFOK-NOZRDPDXSA-N |
| XLogP | 5.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|