C21H19NO — CID 102359954
(2R)-2-amino-2-(4-methylphenyl)-1,2-diphenylethanone (PubChem CID 102359954) has the molecular formula C21H19NO and a molecular weight of 301.39 g/mol. Its IUPAC name is (2R)-2-amino-2-(4-methylphenyl)-1,2-diphenylethanone.
| Compound Name | (2R)-2-amino-2-(4-methylphenyl)-1,2-diphenylethanone |
|---|---|
| PubChem CID | 102359954 |
| Molecular Formula | C21H19NO |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | (2R)-2-amino-2-(4-methylphenyl)-1,2-diphenylethanone |
| SMILES | Cc1ccc([C@@](N)(C(=O)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H19NO/c1-16-12-14-19(15-13-16)21(22,18-10-6-3-7-11-18)20(23)17-8-4-2-5-9-17/h2-15H,22H2,1H3/t21-/m1/s1 |
| InChIKey | ZDUHNTHCVBLFMO-OAQYLSRUSA-N |
| XLogP | 4.08 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |