C21H18O2 — CID 19733760
2-(4-methylphenyl)-2,2-diphenylacetic acid (PubChem CID 19733760) has the molecular formula C21H18O2 and a molecular weight of 302.37 g/mol. Its IUPAC name is 2-(4-methylphenyl)-2,2-diphenylacetic acid.
| Compound Name | 2-(4-methylphenyl)-2,2-diphenylacetic acid |
|---|---|
| PubChem CID | 19733760 |
| Molecular Formula | C21H18O2 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 2-(4-methylphenyl)-2,2-diphenylacetic acid |
| SMILES | Cc1ccc(C(C(=O)O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H18O2/c1-16-12-14-19(15-13-16)21(20(22)23,17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-15H,1H3,(H,22,23) |
| InChIKey | NJSPKFGJUCICJO-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|