C20H13F3O2 — CID 91545050
2,2,2-tris(4-fluorophenyl)acetic acid (PubChem CID 91545050) has the molecular formula C20H13F3O2 and a molecular weight of 342.32 g/mol. Its IUPAC name is 2,2,2-tris(4-fluorophenyl)acetic acid.
| Compound Name | 2,2,2-tris(4-fluorophenyl)acetic acid |
|---|---|
| PubChem CID | 91545050 |
| Molecular Formula | C20H13F3O2 |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 2,2,2-tris(4-fluorophenyl)acetic acid |
| SMILES | O=C(O)C(c1ccc(F)cc1)(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H13F3O2/c21-16-7-1-13(2-8-16)20(19(24)25,14-3-9-17(22)10-4-14)15-5-11-18(23)12-6-15/h1-12H,(H,24,25) |
| InChIKey | OCSFMTWOVVDGMF-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|