C14H11F2NOS — CID 87771670
2,2-bis(4-fluorophenyl)-2-sulfanylacetamide (PubChem CID 87771670) has the molecular formula C14H11F2NOS and a molecular weight of 279.31 g/mol. Its IUPAC name is 2,2-bis(4-fluorophenyl)-2-sulfanylacetamide.
| Compound Name | 2,2-bis(4-fluorophenyl)-2-sulfanylacetamide |
|---|---|
| PubChem CID | 87771670 |
| Molecular Formula | C14H11F2NOS |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 2,2-bis(4-fluorophenyl)-2-sulfanylacetamide |
| SMILES | NC(=O)C(S)(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H11F2NOS/c15-11-5-1-9(2-6-11)14(19,13(17)18)10-3-7-12(16)8-4-10/h1-8,19H,(H2,17,18) |
| InChIKey | POXGOOBLZYNRKS-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|