C15H11BrF3O2- — CID 20636363
bromomethane;2-fluoro-2,2-bis(4-fluorophenyl)acetate (PubChem CID 20636363) has the molecular formula C15H11BrF3O2- and a molecular weight of 360.15 g/mol. Its IUPAC name is bromomethane;2-fluoro-2,2-bis(4-fluorophenyl)acetate.
| Compound Name | bromomethane;2-fluoro-2,2-bis(4-fluorophenyl)acetate |
|---|---|
| PubChem CID | 20636363 |
| Molecular Formula | C15H11BrF3O2- |
| Molecular Weight | 360.15 g/mol |
| Exact Mass | 358.99 |
| IUPAC Name | bromomethane;2-fluoro-2,2-bis(4-fluorophenyl)acetate |
| SMILES | CBr.O=C([O-])C(F)(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H9F3O2.CH3Br/c15-11-5-1-9(2-6-11)14(17,13(18)19)10-3-7-12(16)8-4-10;1-2/h1-8H,(H,18,19);1H3/p-1 |
| InChIKey | UEEFCGXTLJANJI-UHFFFAOYSA-M |
| XLogP | 2.94 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.15 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|