C9H7F2KO2 — CID 141426164
potassium 2,2-difluoro-2-(4-methylphenyl)acetate (PubChem CID 141426164) has the molecular formula C9H7F2KO2 and a molecular weight of 224.25 g/mol. Its IUPAC name is potassium 2,2-difluoro-2-(4-methylphenyl)acetate.
| Compound Name | potassium 2,2-difluoro-2-(4-methylphenyl)acetate |
|---|---|
| PubChem CID | 141426164 |
| Molecular Formula | C9H7F2KO2 |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.01 |
| IUPAC Name | potassium 2,2-difluoro-2-(4-methylphenyl)acetate |
| SMILES | Cc1ccc(C(F)(F)C(=O)[O-])cc1.[K+] |
| InChI | InChI=1S/C9H8F2O2.K/c1-6-2-4-7(5-3-6)9(10,11)8(12)13;/h2-5H,1H3,(H,12,13);/q;+1/p-1 |
| InChIKey | OPXMSRWYRSMXKK-UHFFFAOYSA-M |
| XLogP | -2.16 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |