C11H13F2NO2 — CID 105486323
2-amino-3-fluoro-2-(4-fluorophenyl)-3-methylbutanoic acid (PubChem CID 105486323) has the molecular formula C11H13F2NO2 and a molecular weight of 229.23 g/mol. Its IUPAC name is 2-amino-3-fluoro-2-(4-fluorophenyl)-3-methylbutanoic acid.
| Compound Name | 2-amino-3-fluoro-2-(4-fluorophenyl)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 105486323 |
| Molecular Formula | C11H13F2NO2 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-amino-3-fluoro-2-(4-fluorophenyl)-3-methylbutanoic acid |
| SMILES | CC(C)(F)C(N)(C(=O)O)c1ccc(F)cc1 |
| InChI | InChI=1S/C11H13F2NO2/c1-10(2,13)11(14,9(15)16)7-3-5-8(12)6-4-7/h3-6H,14H2,1-2H3,(H,15,16) |
| InChIKey | OUDCASBJXWFUCC-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |