C9H7ClF3NO2 — CID 131872455
(2R)-2-amino-2-(4-chlorophenyl)-3,3,3-trifluoropropanoic acid (PubChem CID 131872455) has the molecular formula C9H7ClF3NO2 and a molecular weight of 253.61 g/mol. Its IUPAC name is (2R)-2-amino-2-(4-chlorophenyl)-3,3,3-trifluoropropanoic acid.
| Compound Name | (2R)-2-amino-2-(4-chlorophenyl)-3,3,3-trifluoropropanoic acid |
|---|---|
| PubChem CID | 131872455 |
| Molecular Formula | C9H7ClF3NO2 |
| Molecular Weight | 253.61 g/mol |
| Exact Mass | 253.01 |
| IUPAC Name | (2R)-2-amino-2-(4-chlorophenyl)-3,3,3-trifluoropropanoic acid |
| SMILES | N[C@@](C(=O)O)(c1ccc(Cl)cc1)C(F)(F)F |
| InChI | InChI=1S/C9H7ClF3NO2/c10-6-3-1-5(2-4-6)8(14,7(15)16)9(11,12)13/h1-4H,14H2,(H,15,16)/t8-/m1/s1 |
| InChIKey | JXBAPZFXMKLAJK-MRVPVSSYSA-N |
| XLogP | 2.14 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.61 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |