C9H9F3N2O2 — CID 131872483
(2R)-2-amino-2-(4-aminophenyl)-3,3,3-trifluoropropanoic acid (PubChem CID 131872483) has the molecular formula C9H9F3N2O2 and a molecular weight of 234.18 g/mol. Its IUPAC name is (2R)-2-amino-2-(4-aminophenyl)-3,3,3-trifluoropropanoic acid.
| Compound Name | (2R)-2-amino-2-(4-aminophenyl)-3,3,3-trifluoropropanoic acid |
|---|---|
| PubChem CID | 131872483 |
| Molecular Formula | C9H9F3N2O2 |
| Molecular Weight | 234.18 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | (2R)-2-amino-2-(4-aminophenyl)-3,3,3-trifluoropropanoic acid |
| SMILES | Nc1ccc([C@@](N)(C(=O)O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C9H9F3N2O2/c10-9(11,12)8(14,7(15)16)5-1-3-6(13)4-2-5/h1-4H,13-14H2,(H,15,16)/t8-/m1/s1 |
| InChIKey | FHVUGPRKHFWRCY-MRVPVSSYSA-N |
| XLogP | 1.07 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.18 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|