About (2R)-2-amino-3,3,3-trifluoro-2-(1H-pyrrol-2-yl)propanoic acid
(2R)-2-amino-3,3,3-trifluoro-2-(1H-pyrrol-2-yl)propanoic acid (PubChem CID 125180929) has the molecular formula C7H7F3N2O2
and a molecular weight of 208.14 g/mol. Its IUPAC name is (2R)-2-amino-3,3,3-trifluoro-2-(1H-pyrrol-2-yl)propanoic acid.
Analyze (2R)-2-amino-3,3,3-trifluoro-2-(1H-pyrrol-2-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-amino-3,3,3-trifluoro-2-(1H-pyrrol-2-yl)propanoic acid?
The IUPAC name of (2R)-2-amino-3,3,3-trifluoro-2-(1H-pyrrol-2-yl)propanoic acid (CID 125180929) is (2R)-2-amino-3,3,3-trifluoro-2-(1H-pyrrol-2-yl)propanoic acid.
What is the SMILES notation for (2R)-2-amino-3,3,3-trifluoro-2-(1H-pyrrol-2-yl)propanoic acid?
The canonical SMILES for (2R)-2-amino-3,3,3-trifluoro-2-(1H-pyrrol-2-yl)propanoic acid is N[C@@](C(=O)O)(c1ccc[nH]1)C(F)(F)F.
What is the InChIKey of (2R)-2-amino-3,3,3-trifluoro-2-(1H-pyrrol-2-yl)propanoic acid?
The InChIKey is IIYPXQNPQQYUFN-ZCFIWIBFSA-N. The full InChI is InChI=1S/C7H7F3N2O2/c8-7(9,10)6(11,5(13)14)4-2-1-3-12-4/h1-3,12H,11H2,(H,13,14)/t6-/m1/s1.
What are the key properties of (2R)-2-amino-3,3,3-trifluoro-2-(1H-pyrrol-2-yl)propanoic acid?
(2R)-2-amino-3,3,3-trifluoro-2-(1H-pyrrol-2-yl)propanoic acid has a molecular weight of 208.14 g/mol, XLogP of 0.82, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-3,3,3-trifluoro-2-(1H-pyrrol-2-yl)propanoic acid is sourced from PubChem (CID 125180929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).