About (2R)-2-amino-3,3,3-trifluoro-2-(2-fluorophenyl)propanoic acid
(2R)-2-amino-3,3,3-trifluoro-2-(2-fluorophenyl)propanoic acid (PubChem CID 95298200) has the molecular formula C9H7F4NO2
and a molecular weight of 237.15 g/mol. Its IUPAC name is (2R)-2-amino-3,3,3-trifluoro-2-(2-fluorophenyl)propanoic acid.
Analyze (2R)-2-amino-3,3,3-trifluoro-2-(2-fluorophenyl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-amino-3,3,3-trifluoro-2-(2-fluorophenyl)propanoic acid?
The IUPAC name of (2R)-2-amino-3,3,3-trifluoro-2-(2-fluorophenyl)propanoic acid (CID 95298200) is (2R)-2-amino-3,3,3-trifluoro-2-(2-fluorophenyl)propanoic acid.
What is the SMILES notation for (2R)-2-amino-3,3,3-trifluoro-2-(2-fluorophenyl)propanoic acid?
The canonical SMILES for (2R)-2-amino-3,3,3-trifluoro-2-(2-fluorophenyl)propanoic acid is N[C@@](C(=O)O)(c1ccccc1F)C(F)(F)F.
What is the InChIKey of (2R)-2-amino-3,3,3-trifluoro-2-(2-fluorophenyl)propanoic acid?
The InChIKey is RHJJESUFHXMQBS-MRVPVSSYSA-N. The full InChI is InChI=1S/C9H7F4NO2/c10-6-4-2-1-3-5(6)8(14,7(15)16)9(11,12)13/h1-4H,14H2,(H,15,16)/t8-/m1/s1.
What are the key properties of (2R)-2-amino-3,3,3-trifluoro-2-(2-fluorophenyl)propanoic acid?
(2R)-2-amino-3,3,3-trifluoro-2-(2-fluorophenyl)propanoic acid has a molecular weight of 237.15 g/mol, XLogP of 1.63, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-3,3,3-trifluoro-2-(2-fluorophenyl)propanoic acid is sourced from PubChem (CID 95298200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).