C9H6F4O3 — CID 84736706
2,3,3,3-tetrafluoro-2-(2-hydroxyphenyl)propanoic acid (PubChem CID 84736706) has the molecular formula C9H6F4O3 and a molecular weight of 238.14 g/mol. Its IUPAC name is 2,3,3,3-tetrafluoro-2-(2-hydroxyphenyl)propanoic acid.
| Compound Name | 2,3,3,3-tetrafluoro-2-(2-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 84736706 |
| Molecular Formula | C9H6F4O3 |
| Molecular Weight | 238.14 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 2,3,3,3-tetrafluoro-2-(2-hydroxyphenyl)propanoic acid |
| SMILES | O=C(O)C(F)(c1ccccc1O)C(F)(F)F |
| InChI | InChI=1S/C9H6F4O3/c10-8(7(15)16,9(11,12)13)5-3-1-2-4-6(5)14/h1-4,14H,(H,15,16) |
| InChIKey | IALZLRCLTICZIR-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.14 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |