C9H9F4NO — CID 84735412
2-(3-amino-1,1,1,2-tetrafluoropropan-2-yl)phenol (PubChem CID 84735412) has the molecular formula C9H9F4NO and a molecular weight of 223.17 g/mol. Its IUPAC name is 2-(3-amino-1,1,1,2-tetrafluoropropan-2-yl)phenol.
| Compound Name | 2-(3-amino-1,1,1,2-tetrafluoropropan-2-yl)phenol |
|---|---|
| PubChem CID | 84735412 |
| Molecular Formula | C9H9F4NO |
| Molecular Weight | 223.17 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 2-(3-amino-1,1,1,2-tetrafluoropropan-2-yl)phenol |
| SMILES | NCC(F)(c1ccccc1O)C(F)(F)F |
| InChI | InChI=1S/C9H9F4NO/c10-8(5-14,9(11,12)13)6-3-1-2-4-7(6)15/h1-4,15H,5,14H2 |
| InChIKey | BFCKNIJNBQTVDH-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.17 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |