C9H6Cl2F4O2 — CID 154117039
2-(1,3-dichloro-1,1,3,3-tetrafluoro-2-hydroxypropan-2-yl)phenol (PubChem CID 154117039) has the molecular formula C9H6Cl2F4O2 and a molecular weight of 293.04 g/mol. Its IUPAC name is 2-(1,3-dichloro-1,1,3,3-tetrafluoro-2-hydroxypropan-2-yl)phenol.
| Compound Name | 2-(1,3-dichloro-1,1,3,3-tetrafluoro-2-hydroxypropan-2-yl)phenol |
|---|---|
| PubChem CID | 154117039 |
| Molecular Formula | C9H6Cl2F4O2 |
| Molecular Weight | 293.04 g/mol |
| Exact Mass | 291.97 |
| IUPAC Name | 2-(1,3-dichloro-1,1,3,3-tetrafluoro-2-hydroxypropan-2-yl)phenol |
| SMILES | Oc1ccccc1C(O)(C(F)(F)Cl)C(F)(F)Cl |
| InChI | InChI=1S/C9H6Cl2F4O2/c10-8(12,13)7(17,9(11,14)15)5-3-1-2-4-6(5)16/h1-4,16-17H |
| InChIKey | NNWOXDQYSYMDNJ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.04 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|