About 3,3-difluoro-3-(2-hydroxyphenyl)-2,2-dimethylpropanoic acid
3,3-difluoro-3-(2-hydroxyphenyl)-2,2-dimethylpropanoic acid (PubChem CID 105487577) has the molecular formula C11H12F2O3
and a molecular weight of 230.21 g/mol. Its IUPAC name is 3,3-difluoro-3-(2-hydroxyphenyl)-2,2-dimethylpropanoic acid.
Analyze 3,3-difluoro-3-(2-hydroxyphenyl)-2,2-dimethylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-difluoro-3-(2-hydroxyphenyl)-2,2-dimethylpropanoic acid?
The IUPAC name of 3,3-difluoro-3-(2-hydroxyphenyl)-2,2-dimethylpropanoic acid (CID 105487577) is 3,3-difluoro-3-(2-hydroxyphenyl)-2,2-dimethylpropanoic acid.
What is the SMILES notation for 3,3-difluoro-3-(2-hydroxyphenyl)-2,2-dimethylpropanoic acid?
The canonical SMILES for 3,3-difluoro-3-(2-hydroxyphenyl)-2,2-dimethylpropanoic acid is CC(C)(C(=O)O)C(F)(F)c1ccccc1O.
What is the InChIKey of 3,3-difluoro-3-(2-hydroxyphenyl)-2,2-dimethylpropanoic acid?
The InChIKey is ARZFEYLALATINO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F2O3/c1-10(2,9(15)16)11(12,13)7-5-3-4-6-8(7)14/h3-6,14H,1-2H3,(H,15,16).
What are the key properties of 3,3-difluoro-3-(2-hydroxyphenyl)-2,2-dimethylpropanoic acid?
3,3-difluoro-3-(2-hydroxyphenyl)-2,2-dimethylpropanoic acid has a molecular weight of 230.21 g/mol, XLogP of 2.59, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-difluoro-3-(2-hydroxyphenyl)-2,2-dimethylpropanoic acid is sourced from PubChem (CID 105487577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).