About 2-hydroxybenzoic acid;2-[2-(2-hydroxyphenyl)propan-2-yl]phenol
2-hydroxybenzoic acid;2-[2-(2-hydroxyphenyl)propan-2-yl]phenol (PubChem CID 174517600) has the molecular formula C22H22O5
and a molecular weight of 366.41 g/mol. Its IUPAC name is 2-hydroxybenzoic acid;2-[2-(2-hydroxyphenyl)propan-2-yl]phenol.
Molecular Properties
| Compound Name | 2-hydroxybenzoic acid;2-[2-(2-hydroxyphenyl)propan-2-yl]phenol |
| PubChem CID | 174517600 |
| Molecular Formula | C22H22O5 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 2-hydroxybenzoic acid;2-[2-(2-hydroxyphenyl)propan-2-yl]phenol |
| SMILES | CC(C)(c1ccccc1O)c1ccccc1O.O=C(O)c1ccccc1O |
| InChI | InChI=1S/C15H16O2.C7H6O3/c1-15(2,11-7-3-5-9-13(11)16)12-8-4-6-10-14(12)17;8-6-4-2-1-3-5(6)7(9)10/h3-10,16-17H,1-2H3;1-4,8H,(H,9,10) |
| InChIKey | AFOBUANCNPIPDW-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-hydroxybenzoic acid;2-[2-(2-hydroxyphenyl)propan-2-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxybenzoic acid;2-[2-(2-hydroxyphenyl)propan-2-yl]phenol?
The IUPAC name of 2-hydroxybenzoic acid;2-[2-(2-hydroxyphenyl)propan-2-yl]phenol (CID 174517600) is 2-hydroxybenzoic acid;2-[2-(2-hydroxyphenyl)propan-2-yl]phenol.
What is the SMILES notation for 2-hydroxybenzoic acid;2-[2-(2-hydroxyphenyl)propan-2-yl]phenol?
The canonical SMILES for 2-hydroxybenzoic acid;2-[2-(2-hydroxyphenyl)propan-2-yl]phenol is CC(C)(c1ccccc1O)c1ccccc1O.O=C(O)c1ccccc1O.
What is the InChIKey of 2-hydroxybenzoic acid;2-[2-(2-hydroxyphenyl)propan-2-yl]phenol?
The InChIKey is AFOBUANCNPIPDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O2.C7H6O3/c1-15(2,11-7-3-5-9-13(11)16)12-8-4-6-10-14(12)17;8-6-4-2-1-3-5(6)7(9)10/h3-10,16-17H,1-2H3;1-4,8H,(H,9,10).
What are the key properties of 2-hydroxybenzoic acid;2-[2-(2-hydroxyphenyl)propan-2-yl]phenol?
2-hydroxybenzoic acid;2-[2-(2-hydroxyphenyl)propan-2-yl]phenol has a molecular weight of 366.41 g/mol, XLogP of 4.51, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxybenzoic acid;2-[2-(2-hydroxyphenyl)propan-2-yl]phenol is sourced from PubChem (CID 174517600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).