C19H22O3 — CID 141323363
2,4-bis(2-hydroxyphenyl)-2,4-dimethylpentan-3-one (PubChem CID 141323363) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is 2,4-bis(2-hydroxyphenyl)-2,4-dimethylpentan-3-one.
| Compound Name | 2,4-bis(2-hydroxyphenyl)-2,4-dimethylpentan-3-one |
|---|---|
| PubChem CID | 141323363 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 2,4-bis(2-hydroxyphenyl)-2,4-dimethylpentan-3-one |
| SMILES | CC(C)(C(=O)C(C)(C)c1ccccc1O)c1ccccc1O |
| InChI | InChI=1S/C19H22O3/c1-18(2,13-9-5-7-11-15(13)20)17(22)19(3,4)14-10-6-8-12-16(14)21/h5-12,20-21H,1-4H3 |
| InChIKey | HOOVRMNFOCHFEU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |