pentane;2,3,3,3-tetrafluoro-2-(2-fluorophenyl)propanoic acid

C14H17F5O2 — CID 175181509

IUPACpentane;2,3,3,3-tetrafluoro-2-(2-fluorophenyl)propanoic acid
SMILESCCCCC.O=C(O)C(F)(c1ccccc1F)C(F)(F)F
InChIInChI=1S/C9H5F5O2.C5H12/c10-6-4-2-1-3-5(6)8(11,7(15)16)9(12,13)14;1-3-5-4-2/h1-4H,(H,15,16);3-5H2,1-2H3
InChIKeyFXTPLRIINTZHJQ-UHFFFAOYSA-N
MW312.28 g/mol
LogP4.83
Rot. Bonds4

About pentane;2,3,3,3-tetrafluoro-2-(2-fluorophenyl)propanoic acid

pentane;2,3,3,3-tetrafluoro-2-(2-fluorophenyl)propanoic acid (PubChem CID 175181509) has the molecular formula C14H17F5O2 and a molecular weight of 312.28 g/mol. Its IUPAC name is pentane;2,3,3,3-tetrafluoro-2-(2-fluorophenyl)propanoic acid.

Molecular Properties

Compound Namepentane;2,3,3,3-tetrafluoro-2-(2-fluorophenyl)propanoic acid
PubChem CID175181509
Molecular FormulaC14H17F5O2
Molecular Weight312.28 g/mol
Exact Mass312.11
IUPAC Namepentane;2,3,3,3-tetrafluoro-2-(2-fluorophenyl)propanoic acid
SMILESCCCCC.O=C(O)C(F)(c1ccccc1F)C(F)(F)F
InChIInChI=1S/C9H5F5O2.C5H12/c10-6-4-2-1-3-5(6)8(11,7(15)16)9(12,13)14;1-3-5-4-2/h1-4H,(H,15,16);3-5H2,1-2H3
InChIKeyFXTPLRIINTZHJQ-UHFFFAOYSA-N
XLogP4.83
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500312.28
LogP ≤ 54.83
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze pentane;2,3,3,3-tetrafluoro-2-(2-fluorophenyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of pentane;2,3,3,3-tetrafluoro-2-(2-fluorophenyl)propanoic acid?
The IUPAC name of pentane;2,3,3,3-tetrafluoro-2-(2-fluorophenyl)propanoic acid (CID 175181509) is pentane;2,3,3,3-tetrafluoro-2-(2-fluorophenyl)propanoic acid.
What is the SMILES notation for pentane;2,3,3,3-tetrafluoro-2-(2-fluorophenyl)propanoic acid?
The canonical SMILES for pentane;2,3,3,3-tetrafluoro-2-(2-fluorophenyl)propanoic acid is CCCCC.O=C(O)C(F)(c1ccccc1F)C(F)(F)F.
What is the InChIKey of pentane;2,3,3,3-tetrafluoro-2-(2-fluorophenyl)propanoic acid?
The InChIKey is FXTPLRIINTZHJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5F5O2.C5H12/c10-6-4-2-1-3-5(6)8(11,7(15)16)9(12,13)14;1-3-5-4-2/h1-4H,(H,15,16);3-5H2,1-2H3.
What are the key properties of pentane;2,3,3,3-tetrafluoro-2-(2-fluorophenyl)propanoic acid?
pentane;2,3,3,3-tetrafluoro-2-(2-fluorophenyl)propanoic acid has a molecular weight of 312.28 g/mol, XLogP of 4.83, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pentane;2,3,3,3-tetrafluoro-2-(2-fluorophenyl)propanoic acid is sourced from PubChem (CID 175181509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).