C24H38O4 — CID 158765235
2-[2-(4-carboxyoctan-4-yl)phenyl]-2-propylhexanoic acid (PubChem CID 158765235) has the molecular formula C24H38O4 and a molecular weight of 390.56 g/mol. Its IUPAC name is 2-[2-(4-carboxyoctan-4-yl)phenyl]-2-propylhexanoic acid.
| Compound Name | 2-[2-(4-carboxyoctan-4-yl)phenyl]-2-propylhexanoic acid |
|---|---|
| PubChem CID | 158765235 |
| Molecular Formula | C24H38O4 |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | 2-[2-(4-carboxyoctan-4-yl)phenyl]-2-propylhexanoic acid |
| SMILES | CCCCC(CCC)(C(=O)O)c1ccccc1C(CCC)(CCCC)C(=O)O |
| InChI | InChI=1S/C24H38O4/c1-5-9-17-23(15-7-3,21(25)26)19-13-11-12-14-20(19)24(16-8-4,22(27)28)18-10-6-2/h11-14H,5-10,15-18H2,1-4H3,(H,25,26)(H,27,28) |
| InChIKey | IPEDBAHJSOACRG-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |