C14H22O4 — CID 88685515
carbonic acid;2-(2-methylhexan-2-yl)phenol (PubChem CID 88685515) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is carbonic acid;2-(2-methylhexan-2-yl)phenol.
| Compound Name | carbonic acid;2-(2-methylhexan-2-yl)phenol |
|---|---|
| PubChem CID | 88685515 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | carbonic acid;2-(2-methylhexan-2-yl)phenol |
| SMILES | CCCCC(C)(C)c1ccccc1O.O=C(O)O |
| InChI | InChI=1S/C13H20O.CH2O3/c1-4-5-10-13(2,3)11-8-6-7-9-12(11)14;2-1(3)4/h6-9,14H,4-5,10H2,1-3H3;(H2,2,3,4) |
| InChIKey | ZYXYDEGXCLTJAJ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |