C23H32O — CID 54404925
2-(2-methylheptan-2-yl)-4-(2-phenylpropan-2-yl)phenol (PubChem CID 54404925) has the molecular formula C23H32O and a molecular weight of 324.51 g/mol. Its IUPAC name is 2-(2-methylheptan-2-yl)-4-(2-phenylpropan-2-yl)phenol.
| Compound Name | 2-(2-methylheptan-2-yl)-4-(2-phenylpropan-2-yl)phenol |
|---|---|
| PubChem CID | 54404925 |
| Molecular Formula | C23H32O |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.25 |
| IUPAC Name | 2-(2-methylheptan-2-yl)-4-(2-phenylpropan-2-yl)phenol |
| SMILES | CCCCCC(C)(C)c1cc(C(C)(C)c2ccccc2)ccc1O |
| InChI | InChI=1S/C23H32O/c1-6-7-11-16-22(2,3)20-17-19(14-15-21(20)24)23(4,5)18-12-9-8-10-13-18/h8-10,12-15,17,24H,6-7,11,16H2,1-5H3 |
| InChIKey | VPZXZUAPHXYDGF-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|