C24H42O — CID 87300429
2,6-bis(2-methyloctan-2-yl)phenol (PubChem CID 87300429) has the molecular formula C24H42O and a molecular weight of 346.60 g/mol. Its IUPAC name is 2,6-bis(2-methyloctan-2-yl)phenol.
| Compound Name | 2,6-bis(2-methyloctan-2-yl)phenol |
|---|---|
| PubChem CID | 87300429 |
| Molecular Formula | C24H42O |
| Molecular Weight | 346.60 g/mol |
| Exact Mass | 346.32 |
| IUPAC Name | 2,6-bis(2-methyloctan-2-yl)phenol |
| SMILES | CCCCCCC(C)(C)c1cccc(C(C)(C)CCCCCC)c1O |
| InChI | InChI=1S/C24H42O/c1-7-9-11-13-18-23(3,4)20-16-15-17-21(22(20)25)24(5,6)19-14-12-10-8-2/h15-17,25H,7-14,18-19H2,1-6H3 |
| InChIKey | ODLBSGRVQVGTNS-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.60 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|