C32H60N2O — CID 20545732
2,6-bis(7-aminotridecan-7-yl)phenol (PubChem CID 20545732) has the molecular formula C32H60N2O and a molecular weight of 488.85 g/mol. Its IUPAC name is 2,6-bis(7-aminotridecan-7-yl)phenol.
| Compound Name | 2,6-bis(7-aminotridecan-7-yl)phenol |
|---|---|
| PubChem CID | 20545732 |
| Molecular Formula | C32H60N2O |
| Molecular Weight | 488.85 g/mol |
| Exact Mass | 488.47 |
| IUPAC Name | 2,6-bis(7-aminotridecan-7-yl)phenol |
| SMILES | CCCCCCC(N)(CCCCCC)c1cccc(C(N)(CCCCCC)CCCCCC)c1O |
| InChI | InChI=1S/C32H60N2O/c1-5-9-13-17-24-31(33,25-18-14-10-6-2)28-22-21-23-29(30(28)35)32(34,26-19-15-11-7-3)27-20-16-12-8-4/h21-23,35H,5-20,24-27,33-34H2,1-4H3 |
| InChIKey | XLJBPGPKHPVHNW-UHFFFAOYSA-N |
| XLogP | 9.58 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.85 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|