C30H54O — CID 174819612
2,6-bis(5-propylnonan-5-yl)phenol (PubChem CID 174819612) has the molecular formula C30H54O and a molecular weight of 430.76 g/mol. Its IUPAC name is 2,6-bis(5-propylnonan-5-yl)phenol.
| Compound Name | 2,6-bis(5-propylnonan-5-yl)phenol |
|---|---|
| PubChem CID | 174819612 |
| Molecular Formula | C30H54O |
| Molecular Weight | 430.76 g/mol |
| Exact Mass | 430.42 |
| IUPAC Name | 2,6-bis(5-propylnonan-5-yl)phenol |
| SMILES | CCCCC(CCC)(CCCC)c1cccc(C(CCC)(CCCC)CCCC)c1O |
| InChI | InChI=1S/C30H54O/c1-7-13-22-29(20-11-5,23-14-8-2)26-18-17-19-27(28(26)31)30(21-12-6,24-15-9-3)25-16-10-4/h17-19,31H,7-16,20-25H2,1-6H3 |
| InChIKey | ZIVBCXKLIKKWNE-UHFFFAOYSA-N |
| XLogP | 10.23 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.76 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |