C22H38O2 — CID 54503359
3,6-bis(2-methylheptan-2-yl)benzene-1,2-diol (PubChem CID 54503359) has the molecular formula C22H38O2 and a molecular weight of 334.54 g/mol. Its IUPAC name is 3,6-bis(2-methylheptan-2-yl)benzene-1,2-diol.
| Compound Name | 3,6-bis(2-methylheptan-2-yl)benzene-1,2-diol |
|---|---|
| PubChem CID | 54503359 |
| Molecular Formula | C22H38O2 |
| Molecular Weight | 334.54 g/mol |
| Exact Mass | 334.29 |
| IUPAC Name | 3,6-bis(2-methylheptan-2-yl)benzene-1,2-diol |
| SMILES | CCCCCC(C)(C)c1ccc(C(C)(C)CCCCC)c(O)c1O |
| InChI | InChI=1S/C22H38O2/c1-7-9-11-15-21(3,4)17-13-14-18(20(24)19(17)23)22(5,6)16-12-10-8-2/h13-14,23-24H,7-12,15-16H2,1-6H3 |
| InChIKey | YDZKILTWCXVCBB-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.54 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|