C33H52O2 — CID 22325373
2-[[2-hydroxy-5-methyl-3-(2-methyloctan-2-yl)phenyl]methyl]-4-methyl-6-(2-methyloctan-2-yl)phenol (PubChem CID 22325373) has the molecular formula C33H52O2 and a molecular weight of 480.78 g/mol. Its IUPAC name is 2-[[2-hydroxy-5-methyl-3-(2-methyloctan-2-yl)phenyl]methyl]-4-methyl-6-(2-methyloctan-2-yl)phenol.
| Compound Name | 2-[[2-hydroxy-5-methyl-3-(2-methyloctan-2-yl)phenyl]methyl]-4-methyl-6-(2-methyloctan-2-yl)phenol |
|---|---|
| PubChem CID | 22325373 |
| Molecular Formula | C33H52O2 |
| Molecular Weight | 480.78 g/mol |
| Exact Mass | 480.40 |
| IUPAC Name | 2-[[2-hydroxy-5-methyl-3-(2-methyloctan-2-yl)phenyl]methyl]-4-methyl-6-(2-methyloctan-2-yl)phenol |
| SMILES | CCCCCCC(C)(C)c1cc(C)cc(Cc2cc(C)cc(C(C)(C)CCCCCC)c2O)c1O |
| InChI | InChI=1S/C33H52O2/c1-9-11-13-15-17-32(5,6)28-21-24(3)19-26(30(28)34)23-27-20-25(4)22-29(31(27)35)33(7,8)18-16-14-12-10-2/h19-22,34-35H,9-18,23H2,1-8H3 |
| InChIKey | UNZKUNIFJFGMLW-UHFFFAOYSA-N |
| XLogP | 9.80 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.78 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|