C32H50O2 — CID 21053639
2-tert-butyl-6-[10-(3-tert-butyl-2-hydroxy-5-methylphenyl)decyl]-4-methylphenol (PubChem CID 21053639) has the molecular formula C32H50O2 and a molecular weight of 466.75 g/mol. Its IUPAC name is 2-tert-butyl-6-[10-(3-tert-butyl-2-hydroxy-5-methylphenyl)decyl]-4-methylphenol.
| Compound Name | 2-tert-butyl-6-[10-(3-tert-butyl-2-hydroxy-5-methylphenyl)decyl]-4-methylphenol |
|---|---|
| PubChem CID | 21053639 |
| Molecular Formula | C32H50O2 |
| Molecular Weight | 466.75 g/mol |
| Exact Mass | 466.38 |
| IUPAC Name | 2-tert-butyl-6-[10-(3-tert-butyl-2-hydroxy-5-methylphenyl)decyl]-4-methylphenol |
| SMILES | Cc1cc(CCCCCCCCCCc2cc(C)cc(C(C)(C)C)c2O)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C32H50O2/c1-23-19-25(29(33)27(21-23)31(3,4)5)17-15-13-11-9-10-12-14-16-18-26-20-24(2)22-28(30(26)34)32(6,7)8/h19-22,33-34H,9-18H2,1-8H3 |
| InChIKey | LJZUCGJIBOCBQO-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.75 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|