C25H42O3 — CID 22345991
2-hydroxy-3,5-bis(2-methyloctan-2-yl)benzoic acid (PubChem CID 22345991) has the molecular formula C25H42O3 and a molecular weight of 390.61 g/mol. Its IUPAC name is 2-hydroxy-3,5-bis(2-methyloctan-2-yl)benzoic acid.
| Compound Name | 2-hydroxy-3,5-bis(2-methyloctan-2-yl)benzoic acid |
|---|---|
| PubChem CID | 22345991 |
| Molecular Formula | C25H42O3 |
| Molecular Weight | 390.61 g/mol |
| Exact Mass | 390.31 |
| IUPAC Name | 2-hydroxy-3,5-bis(2-methyloctan-2-yl)benzoic acid |
| SMILES | CCCCCCC(C)(C)c1cc(C(=O)O)c(O)c(C(C)(C)CCCCCC)c1 |
| InChI | InChI=1S/C25H42O3/c1-7-9-11-13-15-24(3,4)19-17-20(23(27)28)22(26)21(18-19)25(5,6)16-14-12-10-8-2/h17-18,26H,7-16H2,1-6H3,(H,27,28) |
| InChIKey | VVWLMIIPVUNREW-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.61 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|