C35H62O5 — CID 175494515
butyl 2-(2-hydroxyphenyl)-2-methylhexanoate;octadecanoic acid (PubChem CID 175494515) has the molecular formula C35H62O5 and a molecular weight of 562.88 g/mol. Its IUPAC name is butyl 2-(2-hydroxyphenyl)-2-methylhexanoate;octadecanoic acid.
| Compound Name | butyl 2-(2-hydroxyphenyl)-2-methylhexanoate;octadecanoic acid |
|---|---|
| PubChem CID | 175494515 |
| Molecular Formula | C35H62O5 |
| Molecular Weight | 562.88 g/mol |
| Exact Mass | 562.46 |
| IUPAC Name | butyl 2-(2-hydroxyphenyl)-2-methylhexanoate;octadecanoic acid |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)O.CCCCOC(=O)C(C)(CCCC)c1ccccc1O |
| InChI | InChI=1S/C18H36O2.C17H26O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-4-6-12-17(3,16(19)20-13-7-5-2)14-10-8-9-11-15(14)18/h2-17H2,1H3,(H,19,20);8-11,18H,4-7,12-13H2,1-3H3 |
| InChIKey | OBOYOAWJOJOVJP-UHFFFAOYSA-N |
| XLogP | 10.52 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.88 |
| LogP ≤ 5 | 10.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|